C19H33N5 — CID 41041937
3-amino-5-[5-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]pentyl]-1H-pyrazole-4-carbonitrile (PubChem CID 41041937) has the molecular formula C19H33N5 and a molecular weight of 331.51 g/mol. Its IUPAC name is 3-amino-5-[5-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]pentyl]-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-amino-5-[5-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]pentyl]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 41041937 |
| Molecular Formula | C19H33N5 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 3-amino-5-[5-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]amino]pentyl]-1H-pyrazole-4-carbonitrile |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1NCCCCCc1[nH]nc(N)c1C#N |
| InChI | InChI=1S/C19H33N5/c1-13(2)15-9-8-14(3)11-18(15)22-10-6-4-5-7-17-16(12-20)19(21)24-23-17/h13-15,18,22H,4-11H2,1-3H3,(H3,21,23,24)/t14-,15-,18-/m1/s1 |
| InChIKey | XKDHYEOFUXGLJE-IIDMSEBBSA-N |
| XLogP | 3.63 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|