C16H26N6O — CID 94173658
1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]urea (PubChem CID 94173658) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]urea.
| Compound Name | 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]urea |
|---|---|
| PubChem CID | 94173658 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]urea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)NCCCc1[nH]nc(N)c1C#N |
| InChI | InChI=1S/C16H26N6O/c1-10-5-3-6-13(11(10)2)20-16(23)19-8-4-7-14-12(9-17)15(18)22-21-14/h10-11,13H,3-8H2,1-2H3,(H3,18,21,22)(H2,19,20,23)/t10-,11-,13-/m1/s1 |
| InChIKey | HDXJAWVMJIAWTR-NQBHXWOUSA-N |
| XLogP | 1.92 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|