C18H23N7O3 — CID 154761383
N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3-(2-nitroanilino)propanamide (PubChem CID 154761383) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3-(2-nitroanilino)propanamide.
| Compound Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 154761383 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3-(2-nitroanilino)propanamide |
| SMILES | N#Cc1c(N)n[nH]c1CCCCCNC(=O)CCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N7O3/c19-12-13-14(23-24-18(13)20)6-2-1-5-10-22-17(26)9-11-21-15-7-3-4-8-16(15)25(27)28/h3-4,7-8,21H,1-2,5-6,9-11H2,(H,22,26)(H3,20,23,24) |
| InChIKey | MZQMFLXQIOGWPJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|