C14H28N6OS — CID 110935005
1-(2-methoxyethyl)-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine (PubChem CID 110935005) has the molecular formula C14H28N6OS and a molecular weight of 328.49 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine.
| Compound Name | 1-(2-methoxyethyl)-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 110935005 |
| Molecular Formula | C14H28N6OS |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-(2-methoxyethyl)-2-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine |
| SMILES | COCCN/C(N)=N/CCCc1nnc(SC)n1CC(C)C |
| InChI | InChI=1S/C14H28N6OS/c1-11(2)10-20-12(18-19-14(20)22-4)6-5-7-16-13(15)17-8-9-21-3/h11H,5-10H2,1-4H3,(H3,15,16,17) |
| InChIKey | TXDNWTSCGLRFKX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|