C17H33IN6S — CID 110935010
4-methyl-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 110935010) has the molecular formula C17H33IN6S and a molecular weight of 480.46 g/mol. Its IUPAC name is 4-methyl-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-methyl-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110935010 |
| Molecular Formula | C17H33IN6S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 4-methyl-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CSc1nnc(CCC/N=C(\N)N2CCC(C)CC2)n1CC(C)C.I |
| InChI | InChI=1S/C17H32N6S.HI/c1-13(2)12-23-15(20-21-17(23)24-4)6-5-9-19-16(18)22-10-7-14(3)8-11-22;/h13-14H,5-12H2,1-4H3,(H2,18,19);1H |
| InChIKey | WPGKCLQOUWRIQL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|