C24H39IN6S — CID 111724730
3-benzyl-N-ethyl-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111724730) has the molecular formula C24H39IN6S and a molecular weight of 570.59 g/mol. Its IUPAC name is 3-benzyl-N-ethyl-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-benzyl-N-ethyl-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111724730 |
| Molecular Formula | C24H39IN6S |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 3-benzyl-N-ethyl-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1CC(C)C)N1CCC(Cc2ccccc2)C1.I |
| InChI | InChI=1S/C24H38N6S.HI/c1-5-25-23(29-15-13-21(18-29)16-20-10-7-6-8-11-20)26-14-9-12-22-27-28-24(31-4)30(22)17-19(2)3;/h6-8,10-11,19,21H,5,9,12-18H2,1-4H3,(H,25,26);1H |
| InChIKey | QAQRAQPCRWLVFI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|