C21H40N6S — CID 111734181
N-ethyl-3-(2-methylpropyl)-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]pyrrolidine-1-carboximidamide (PubChem CID 111734181) has the molecular formula C21H40N6S and a molecular weight of 408.66 g/mol. Its IUPAC name is N-ethyl-3-(2-methylpropyl)-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(2-methylpropyl)-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111734181 |
| Molecular Formula | C21H40N6S |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | N-ethyl-3-(2-methylpropyl)-N'-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nnc(SC)n1CC(C)C)N1CCC(CC(C)C)C1 |
| InChI | InChI=1S/C21H40N6S/c1-7-22-20(26-12-10-18(15-26)13-16(2)3)23-11-8-9-19-24-25-21(28-6)27(19)14-17(4)5/h16-18H,7-15H2,1-6H3,(H,22,23) |
| InChIKey | ZDXBLAONBDJANB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|