About 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide
3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide (PubChem CID 165468982) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide.
Analyze 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide?
The IUPAC name of 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide (CID 165468982) is 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide.
What is the SMILES notation for 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide?
The canonical SMILES for 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide is CCCCc1n[nH]c2c1CS(=O)(=O)CC2.
What is the InChIKey of 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide?
The InChIKey is KCZGLYLVGKFZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-2-3-4-9-8-7-15(13,14)6-5-10(8)12-11-9/h2-7H2,1H3,(H,11,12).
What are the key properties of 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide?
3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide has a molecular weight of 228.32 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazole 5,5-dioxide is sourced from PubChem (CID 165468982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).