C15H17BrOS — CID 71155154
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran-6-yl-(4-bromophenyl)methanone (PubChem CID 71155154) has the molecular formula C15H17BrOS and a molecular weight of 325.27 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran-6-yl-(4-bromophenyl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran-6-yl-(4-bromophenyl)methanone |
|---|---|
| PubChem CID | 71155154 |
| Molecular Formula | C15H17BrOS |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran-6-yl-(4-bromophenyl)methanone |
| SMILES | O=C(c1ccc(Br)cc1)C1CC2CCCSC2C1 |
| InChI | InChI=1S/C15H17BrOS/c16-13-5-3-10(4-6-13)15(17)12-8-11-2-1-7-18-14(11)9-12/h3-6,11-12,14H,1-2,7-9H2 |
| InChIKey | DKTXDLVPWIIMRN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |