C18H23N3O3 — CID 71157478
N'-[(2-methoxy-4-methylcyclohexa-1,5-dien-1-yl)methyl]-N-(2-pyridin-2-ylethyl)oxamide (PubChem CID 71157478) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N'-[(2-methoxy-4-methylcyclohexa-1,5-dien-1-yl)methyl]-N-(2-pyridin-2-ylethyl)oxamide.
| Compound Name | N'-[(2-methoxy-4-methylcyclohexa-1,5-dien-1-yl)methyl]-N-(2-pyridin-2-ylethyl)oxamide |
|---|---|
| PubChem CID | 71157478 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N'-[(2-methoxy-4-methylcyclohexa-1,5-dien-1-yl)methyl]-N-(2-pyridin-2-ylethyl)oxamide |
| SMILES | COC1=C(CNC(=O)C(=O)NCCc2ccccn2)C=CC(C)C1 |
| InChI | InChI=1S/C18H23N3O3/c1-13-6-7-14(16(11-13)24-2)12-21-18(23)17(22)20-10-8-15-5-3-4-9-19-15/h3-7,9,13H,8,10-12H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | LWOZDSKPRTZMIS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|