C21H37N3O13 — CID 71158504
(2S,4S,5R)-2-[(3S,4R,6R)-6-(2-azidoethoxy)-4-[(4R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-2-(hydroxymethyl)-5-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71158504) has the molecular formula C21H37N3O13 and a molecular weight of 539.54 g/mol. Its IUPAC name is (2S,4S,5R)-2-[(3S,4R,6R)-6-(2-azidoethoxy)-4-[(4R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-2-(hydroxymethyl)-5-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,4S,5R)-2-[(3S,4R,6R)-6-(2-azidoethoxy)-4-[(4R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-2-(hydroxymethyl)-5-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71158504 |
| Molecular Formula | C21H37N3O13 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | (2S,4S,5R)-2-[(3S,4R,6R)-6-(2-azidoethoxy)-4-[(4R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-2-(hydroxymethyl)-5-methyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC1[C@H](OCCN=[N+]=[N-])OC(CO)[C@@H](O[C@@H]2OC(CO)[C@H](O)[C@H](O)C2O)[C@@H]1OC1C[C@@H](O)C(O)[C@H](C)O1 |
| InChI | InChI=1S/C21H37N3O13/c1-8-18(36-13-5-10(27)14(28)9(2)33-13)19(12(7-26)35-20(8)32-4-3-23-24-22)37-21-17(31)16(30)15(29)11(6-25)34-21/h8-21,25-31H,3-7H2,1-2H3/t8?,9-,10+,11?,12?,13?,14?,15-,16-,17?,18+,19+,20+,21-/m0/s1 |
| InChIKey | BUXQCRZEAVIGTI-WEGCMHIISA-N |
| XLogP | -2.91 |
| TPSA | 245.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|