C27H33N3O7 — CID 71159034
(12aR)-4-(dimethylamino)-3,6,10,11-tetrahydroxy-6-methyl-1,12-dioxo-N-(pyrrolidin-1-ylmethyl)-4a,5,5a,12a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 71159034) has the molecular formula C27H33N3O7 and a molecular weight of 511.58 g/mol. Its IUPAC name is (12aR)-4-(dimethylamino)-3,6,10,11-tetrahydroxy-6-methyl-1,12-dioxo-N-(pyrrolidin-1-ylmethyl)-4a,5,5a,12a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (12aR)-4-(dimethylamino)-3,6,10,11-tetrahydroxy-6-methyl-1,12-dioxo-N-(pyrrolidin-1-ylmethyl)-4a,5,5a,12a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 71159034 |
| Molecular Formula | C27H33N3O7 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (12aR)-4-(dimethylamino)-3,6,10,11-tetrahydroxy-6-methyl-1,12-dioxo-N-(pyrrolidin-1-ylmethyl)-4a,5,5a,12a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@H]2C(=O)C3=C(O)c4c(O)cccc4C(C)(O)C3CC12 |
| InChI | InChI=1S/C27H33N3O7/c1-27(37)14-7-6-8-16(31)18(14)24(34)19-15(27)11-13-17(22(19)32)23(33)20(25(35)21(13)29(2)3)26(36)28-12-30-9-4-5-10-30/h6-8,13,15,17,21,31,34-35,37H,4-5,9-12H2,1-3H3,(H,28,36)/t13?,15?,17-,21?,27?/m1/s1 |
| InChIKey | HEBULRPZDUTKSX-JJILEBGVSA-N |
| XLogP | 1.20 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|