C6H10F2O5 — CID 71165156
(2R,4S,5R)-6-(difluoromethyl)oxane-2,3,4,5-tetrol (PubChem CID 71165156) has the molecular formula C6H10F2O5 and a molecular weight of 200.14 g/mol. Its IUPAC name is (2R,4S,5R)-6-(difluoromethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,4S,5R)-6-(difluoromethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 71165156 |
| Molecular Formula | C6H10F2O5 |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (2R,4S,5R)-6-(difluoromethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC1[C@H](O)OC(C(F)F)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10F2O5/c7-5(8)4-2(10)1(9)3(11)6(12)13-4/h1-6,9-12H/t1-,2+,3?,4?,6+/m0/s1 |
| InChIKey | CSWKRWZKIUAKKR-GGJCPTGHSA-N |
| XLogP | -1.95 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |