C6H12O9S — CID 101411214
hydroxy-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 101411214) has the molecular formula C6H12O9S and a molecular weight of 260.22 g/mol. Its IUPAC name is hydroxy-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | hydroxy-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 101411214 |
| Molecular Formula | C6H12O9S |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | hydroxy-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | O=S(=O)(O)C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O9S/c7-1-2(8)4(6(11)16(12,13)14)15-5(10)3(1)9/h1-11H,(H,12,13,14)/t1-,2+,3+,4-,5?,6?/m0/s1 |
| InChIKey | JCODMNFVIYJLPB-FRVRDERJSA-N |
| XLogP | -4.01 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|