C6H10O6 — CID 88900541
2-hydroxy-2-(3,4,5-trihydroxyoxolan-2-yl)acetaldehyde (PubChem CID 88900541) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is 2-hydroxy-2-(3,4,5-trihydroxyoxolan-2-yl)acetaldehyde.
| Compound Name | 2-hydroxy-2-(3,4,5-trihydroxyoxolan-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 88900541 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2-hydroxy-2-(3,4,5-trihydroxyoxolan-2-yl)acetaldehyde |
| SMILES | O=CC(O)C1OC(O)C(O)C1O |
| InChI | InChI=1S/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h1-6,8-11H |
| InChIKey | UZZNXCDPXDZIMX-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|