C6H11FO6 — CID 67723200
6-[fluoro(hydroxy)methyl]oxane-2,3,4,5-tetrol (PubChem CID 67723200) has the molecular formula C6H11FO6 and a molecular weight of 198.15 g/mol. Its IUPAC name is 6-[fluoro(hydroxy)methyl]oxane-2,3,4,5-tetrol.
| Compound Name | 6-[fluoro(hydroxy)methyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 67723200 |
| Molecular Formula | C6H11FO6 |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 6-[fluoro(hydroxy)methyl]oxane-2,3,4,5-tetrol |
| SMILES | OC(F)C1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C6H11FO6/c7-5(11)4-2(9)1(8)3(10)6(12)13-4/h1-6,8-12H |
| InChIKey | PIZFDKUSPXBELC-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |