C5H9O8P-2 — CID 102233403
[hydroxy-[(2S,3S,4S)-3,4,5-trihydroxyoxolan-2-yl]methyl]-trioxidophosphanium (PubChem CID 102233403) has the molecular formula C5H9O8P-2 and a molecular weight of 228.09 g/mol. Its IUPAC name is [hydroxy-[(2S,3S,4S)-3,4,5-trihydroxyoxolan-2-yl]methyl]-trioxidophosphanium.
| Compound Name | [hydroxy-[(2S,3S,4S)-3,4,5-trihydroxyoxolan-2-yl]methyl]-trioxidophosphanium |
|---|---|
| PubChem CID | 102233403 |
| Molecular Formula | C5H9O8P-2 |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | [hydroxy-[(2S,3S,4S)-3,4,5-trihydroxyoxolan-2-yl]methyl]-trioxidophosphanium |
| SMILES | [O-][P+]([O-])([O-])C(O)[C@H]1OC(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H11O8P/c6-1-2(7)4(8)13-3(1)5(9)14(10,11)12/h1-9H,(H2,10,11,12)/p-2/t1-,2-,3-,4?,5?/m0/s1 |
| InChIKey | HUUKSVAGWXODPD-IQJZEPRVSA-L |
| XLogP | -5.41 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|