C24H20NO3+ — CID 71165337
propyl 20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene-17-carboxylate (PubChem CID 71165337) has the molecular formula C24H20NO3+ and a molecular weight of 370.43 g/mol. Its IUPAC name is propyl 20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene-17-carboxylate.
| Compound Name | propyl 20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene-17-carboxylate |
|---|---|
| PubChem CID | 71165337 |
| Molecular Formula | C24H20NO3+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | propyl 20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene-17-carboxylate |
| SMILES | CCCOC(=O)c1ccc2c3cccc4c3c([n+](C)c2c1)-c1ccccc1O4 |
| InChI | InChI=1S/C24H20NO3/c1-3-13-27-24(26)15-11-12-16-17-8-6-10-21-22(17)23(25(2)19(16)14-15)18-7-4-5-9-20(18)28-21/h4-12,14H,3,13H2,1-2H3/q+1 |
| InChIKey | ORKQFMCYSHZJGP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|