C22H21N3O4 — CID 71167341
ethyl 2-cyano-2-[4-(2-methoxy-2-oxoethyl)-3-phenyl-1,4-dihydroquinazolin-2-ylidene]acetate (PubChem CID 71167341) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is ethyl 2-cyano-2-[4-(2-methoxy-2-oxoethyl)-3-phenyl-1,4-dihydroquinazolin-2-ylidene]acetate.
| Compound Name | ethyl 2-cyano-2-[4-(2-methoxy-2-oxoethyl)-3-phenyl-1,4-dihydroquinazolin-2-ylidene]acetate |
|---|---|
| PubChem CID | 71167341 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | ethyl 2-cyano-2-[4-(2-methoxy-2-oxoethyl)-3-phenyl-1,4-dihydroquinazolin-2-ylidene]acetate |
| SMILES | CCOC(=O)C(C#N)=C1Nc2ccccc2C(CC(=O)OC)N1c1ccccc1 |
| InChI | InChI=1S/C22H21N3O4/c1-3-29-22(27)17(14-23)21-24-18-12-8-7-11-16(18)19(13-20(26)28-2)25(21)15-9-5-4-6-10-15/h4-12,19,24H,3,13H2,1-2H3 |
| InChIKey | UNFMQWFQSUGXFM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|