C16H27N5O4 — CID 71167965
tert-butyl (3R)-3-[(2-hydroxy-3-imidazol-1-ylpropyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 71167965) has the molecular formula C16H27N5O4 and a molecular weight of 353.42 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(2-hydroxy-3-imidazol-1-ylpropyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(2-hydroxy-3-imidazol-1-ylpropyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71167965 |
| Molecular Formula | C16H27N5O4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | tert-butyl (3R)-3-[(2-hydroxy-3-imidazol-1-ylpropyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C(=O)NCC(O)Cn2ccnc2)C1 |
| InChI | InChI=1S/C16H27N5O4/c1-16(2,3)25-15(24)21-7-5-18-13(10-21)14(23)19-8-12(22)9-20-6-4-17-11-20/h4,6,11-13,18,22H,5,7-10H2,1-3H3,(H,19,23)/t12?,13-/m1/s1 |
| InChIKey | QTSFEVUQVPCYMO-ZGTCLIOFSA-N |
| XLogP | -0.43 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |