C23H27N3O3 — CID 71169164
6-hydroxy-2-[4-[3-(3-hydroxypyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 71169164) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 6-hydroxy-2-[4-[3-(3-hydroxypyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-hydroxy-2-[4-[3-(3-hydroxypyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 71169164 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 6-hydroxy-2-[4-[3-(3-hydroxypyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccc(O)cc2CCN1c1ccc(N2CCC(N3CCC(O)C3)C2)cc1 |
| InChI | InChI=1S/C23H27N3O3/c27-20-5-6-22-16(13-20)7-12-26(23(22)29)18-3-1-17(2-4-18)24-10-8-19(14-24)25-11-9-21(28)15-25/h1-6,13,19,21,27-28H,7-12,14-15H2 |
| InChIKey | HLKVSXLUAFMVME-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|