C27H34N4O2 — CID 71169861
2-[4-(cyclopentanecarbonylamino)phenyl]-N-heptan-2-yl-3H-benzimidazole-5-carboxamide (PubChem CID 71169861) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 2-[4-(cyclopentanecarbonylamino)phenyl]-N-heptan-2-yl-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(cyclopentanecarbonylamino)phenyl]-N-heptan-2-yl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 71169861 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 2-[4-(cyclopentanecarbonylamino)phenyl]-N-heptan-2-yl-3H-benzimidazole-5-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1ccc2nc(-c3ccc(NC(=O)C4CCCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H34N4O2/c1-3-4-5-8-18(2)28-27(33)21-13-16-23-24(17-21)31-25(30-23)19-11-14-22(15-12-19)29-26(32)20-9-6-7-10-20/h11-18,20H,3-10H2,1-2H3,(H,28,33)(H,29,32)(H,30,31) |
| InChIKey | JPTHSPSCFFDGIU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|