C29H31FN4O2 — CID 71170091
2-[4-[(4-fluorobenzoyl)amino]phenyl]-N-octan-3-yl-3H-benzimidazole-5-carboxamide (PubChem CID 71170091) has the molecular formula C29H31FN4O2 and a molecular weight of 486.59 g/mol. Its IUPAC name is 2-[4-[(4-fluorobenzoyl)amino]phenyl]-N-octan-3-yl-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-[(4-fluorobenzoyl)amino]phenyl]-N-octan-3-yl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 71170091 |
| Molecular Formula | C29H31FN4O2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-[4-[(4-fluorobenzoyl)amino]phenyl]-N-octan-3-yl-3H-benzimidazole-5-carboxamide |
| SMILES | CCCCCC(CC)NC(=O)c1ccc2nc(-c3ccc(NC(=O)c4ccc(F)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C29H31FN4O2/c1-3-5-6-7-23(4-2)31-29(36)21-12-17-25-26(18-21)34-27(33-25)19-10-15-24(16-11-19)32-28(35)20-8-13-22(30)14-9-20/h8-18,23H,3-7H2,1-2H3,(H,31,36)(H,32,35)(H,33,34) |
| InChIKey | JMUFOQHWXZJASW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|