C27H39N5 — CID 71170017
6-[4-(1-ethylbenzimidazol-2-yl)piperazin-1-yl]-2-methyl-3-(2-methylphenyl)hexan-3-amine (PubChem CID 71170017) has the molecular formula C27H39N5 and a molecular weight of 433.64 g/mol. Its IUPAC name is 6-[4-(1-ethylbenzimidazol-2-yl)piperazin-1-yl]-2-methyl-3-(2-methylphenyl)hexan-3-amine.
| Compound Name | 6-[4-(1-ethylbenzimidazol-2-yl)piperazin-1-yl]-2-methyl-3-(2-methylphenyl)hexan-3-amine |
|---|---|
| PubChem CID | 71170017 |
| Molecular Formula | C27H39N5 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | 6-[4-(1-ethylbenzimidazol-2-yl)piperazin-1-yl]-2-methyl-3-(2-methylphenyl)hexan-3-amine |
| SMILES | CCn1c(N2CCN(CCCC(N)(c3ccccc3C)C(C)C)CC2)nc2ccccc21 |
| InChI | InChI=1S/C27H39N5/c1-5-32-25-14-9-8-13-24(25)29-26(32)31-19-17-30(18-20-31)16-10-15-27(28,21(2)3)23-12-7-6-11-22(23)4/h6-9,11-14,21H,5,10,15-20,28H2,1-4H3 |
| InChIKey | BFTPTWABWMYONN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |