C14H19FO — CID 71170245
8-fluoro-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran (PubChem CID 71170245) has the molecular formula C14H19FO and a molecular weight of 222.30 g/mol. Its IUPAC name is 8-fluoro-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran.
| Compound Name | 8-fluoro-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran |
|---|---|
| PubChem CID | 71170245 |
| Molecular Formula | C14H19FO |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 8-fluoro-3,7-dimethyl-2,3,4,4a,5,8,9,9b-octahydroindeno[1,2-b]pyran |
| SMILES | CC1=CC2=C(CC1F)C1OCC(C)CC1C2 |
| InChI | InChI=1S/C14H19FO/c1-8-3-11-5-10-4-9(2)13(15)6-12(10)14(11)16-7-8/h4,8,11,13-14H,3,5-7H2,1-2H3 |
| InChIKey | PGRSAVSBNSPZOF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |