C39H35N3O2 — CID 71172358
1-(7-methylnaphthalen-2-yl)oxy-3-(N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]anilino)propan-2-ol (PubChem CID 71172358) has the molecular formula C39H35N3O2 and a molecular weight of 577.73 g/mol. Its IUPAC name is 1-(7-methylnaphthalen-2-yl)oxy-3-(N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]anilino)propan-2-ol.
| Compound Name | 1-(7-methylnaphthalen-2-yl)oxy-3-(N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]anilino)propan-2-ol |
|---|---|
| PubChem CID | 71172358 |
| Molecular Formula | C39H35N3O2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 1-(7-methylnaphthalen-2-yl)oxy-3-(N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]anilino)propan-2-ol |
| SMILES | Cc1ccc2ccc(OCC(O)CN(/N=C\c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C39H35N3O2/c1-30-17-20-32-21-24-39(26-33(32)25-30)44-29-38(43)28-41(34-11-5-2-6-12-34)40-27-31-18-22-37(23-19-31)42(35-13-7-3-8-14-35)36-15-9-4-10-16-36/h2-27,38,43H,28-29H2,1H3/b40-27- |
| InChIKey | WWYHIQLARPRMGD-DPVRLLIJSA-N |
| XLogP | 8.90 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|