C25H33N3O3S — CID 71176654
N-[4-(3-amino-6-ethoxy-1-hexan-3-ylindol-2-yl)phenyl]cyclopropanesulfonamide (PubChem CID 71176654) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is N-[4-(3-amino-6-ethoxy-1-hexan-3-ylindol-2-yl)phenyl]cyclopropanesulfonamide.
| Compound Name | N-[4-(3-amino-6-ethoxy-1-hexan-3-ylindol-2-yl)phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 71176654 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[4-(3-amino-6-ethoxy-1-hexan-3-ylindol-2-yl)phenyl]cyclopropanesulfonamide |
| SMILES | CCCC(CC)n1c(-c2ccc(NS(=O)(=O)C3CC3)cc2)c(N)c2ccc(OCC)cc21 |
| InChI | InChI=1S/C25H33N3O3S/c1-4-7-19(5-2)28-23-16-20(31-6-3)12-15-22(23)24(26)25(28)17-8-10-18(11-9-17)27-32(29,30)21-13-14-21/h8-12,15-16,19,21,27H,4-7,13-14,26H2,1-3H3 |
| InChIKey | GXVVHHXRCVNGHY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |