C27H20ClFN4O — CID 71180781
N-[(2-chloro-4-fluorophenyl)methyl]-6-(3-methoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71180781) has the molecular formula C27H20ClFN4O and a molecular weight of 470.94 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-6-(3-methoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-6-(3-methoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71180781 |
| Molecular Formula | C27H20ClFN4O |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-6-(3-methoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COc1cccc(-c2ccc3nc(-c4cccnc4)nc(NCc4ccc(F)cc4Cl)c3c2)c1 |
| InChI | InChI=1S/C27H20ClFN4O/c1-34-22-6-2-4-17(12-22)18-8-10-25-23(13-18)27(31-16-19-7-9-21(29)14-24(19)28)33-26(32-25)20-5-3-11-30-15-20/h2-15H,16H2,1H3,(H,31,32,33) |
| InChIKey | ZDGLRQJNTIFUBP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |