C25H27ClN4O2 — CID 71187173
3-[[5-chloro-4-(piperidine-1-carbonyl)isoquinolin-1-yl]amino]-N-ethyl-2-methylbenzamide (PubChem CID 71187173) has the molecular formula C25H27ClN4O2 and a molecular weight of 450.97 g/mol. Its IUPAC name is 3-[[5-chloro-4-(piperidine-1-carbonyl)isoquinolin-1-yl]amino]-N-ethyl-2-methylbenzamide.
| Compound Name | 3-[[5-chloro-4-(piperidine-1-carbonyl)isoquinolin-1-yl]amino]-N-ethyl-2-methylbenzamide |
|---|---|
| PubChem CID | 71187173 |
| Molecular Formula | C25H27ClN4O2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-[[5-chloro-4-(piperidine-1-carbonyl)isoquinolin-1-yl]amino]-N-ethyl-2-methylbenzamide |
| SMILES | CCNC(=O)c1cccc(Nc2ncc(C(=O)N3CCCCC3)c3c(Cl)cccc23)c1C |
| InChI | InChI=1S/C25H27ClN4O2/c1-3-27-24(31)17-9-8-12-21(16(17)2)29-23-18-10-7-11-20(26)22(18)19(15-28-23)25(32)30-13-5-4-6-14-30/h7-12,15H,3-6,13-14H2,1-2H3,(H,27,31)(H,28,29) |
| InChIKey | YHAXGEJBPVMDSU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |