C19H22N6O3S — CID 71193150
N-[3-(methanesulfonamido)propyl]-1-(6-methyl-3-pyridinyl)-5-pyridin-2-ylpyrazole-3-carboxamide (PubChem CID 71193150) has the molecular formula C19H22N6O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)propyl]-1-(6-methyl-3-pyridinyl)-5-pyridin-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[3-(methanesulfonamido)propyl]-1-(6-methyl-3-pyridinyl)-5-pyridin-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71193150 |
| Molecular Formula | C19H22N6O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[3-(methanesulfonamido)propyl]-1-(6-methyl-3-pyridinyl)-5-pyridin-2-ylpyrazole-3-carboxamide |
| SMILES | Cc1ccc(-n2nc(C(=O)NCCCNS(C)(=O)=O)cc2-c2ccccn2)cn1 |
| InChI | InChI=1S/C19H22N6O3S/c1-14-7-8-15(13-22-14)25-18(16-6-3-4-9-20-16)12-17(24-25)19(26)21-10-5-11-23-29(2,27)28/h3-4,6-9,12-13,23H,5,10-11H2,1-2H3,(H,21,26) |
| InChIKey | GISQZHLJMKOFSQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|