C21H14ClN3O2S — CID 7119556
2-[[(4S)-4-(4-chlorophenyl)-3-cyano-5-oxo-4,4a-dihydroindeno[1,2-b]pyridin-2-yl]sulfanyl]acetamide (PubChem CID 7119556) has the molecular formula C21H14ClN3O2S and a molecular weight of 407.88 g/mol. Its IUPAC name is 2-[[(4S)-4-(4-chlorophenyl)-3-cyano-5-oxo-4,4a-dihydroindeno[1,2-b]pyridin-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[(4S)-4-(4-chlorophenyl)-3-cyano-5-oxo-4,4a-dihydroindeno[1,2-b]pyridin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7119556 |
| Molecular Formula | C21H14ClN3O2S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 2-[[(4S)-4-(4-chlorophenyl)-3-cyano-5-oxo-4,4a-dihydroindeno[1,2-b]pyridin-2-yl]sulfanyl]acetamide |
| SMILES | N#CC1=C(SCC(N)=O)N=C2c3ccccc3C(=O)C2[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14ClN3O2S/c22-12-7-5-11(6-8-12)17-15(9-23)21(28-10-16(24)26)25-19-13-3-1-2-4-14(13)20(27)18(17)19/h1-8,17-18H,10H2,(H2,24,26)/t17-,18?/m0/s1 |
| InChIKey | AYIYLJYYCSCKPP-ZENAZSQFSA-N |
| XLogP | 3.69 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_B(1)', 'substructure': 'N/A'} |
|---|