C20H30O3S — CID 71196223
(5S,6R,10S,11S,13R)-6,10-dimethyl-14-(methylsulfinylmethyl)tetracyclo[11.1.1.02,11.05,10]pentadec-1-ene-6-carboxylic acid (PubChem CID 71196223) has the molecular formula C20H30O3S and a molecular weight of 350.52 g/mol. Its IUPAC name is (5S,6R,10S,11S,13R)-6,10-dimethyl-14-(methylsulfinylmethyl)tetracyclo[11.1.1.02,11.05,10]pentadec-1-ene-6-carboxylic acid.
| Compound Name | (5S,6R,10S,11S,13R)-6,10-dimethyl-14-(methylsulfinylmethyl)tetracyclo[11.1.1.02,11.05,10]pentadec-1-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 71196223 |
| Molecular Formula | C20H30O3S |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (5S,6R,10S,11S,13R)-6,10-dimethyl-14-(methylsulfinylmethyl)tetracyclo[11.1.1.02,11.05,10]pentadec-1-ene-6-carboxylic acid |
| SMILES | CS(=O)CC1C2=C3CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)O)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C20H30O3S/c1-19-7-4-8-20(2,18(21)22)17(19)6-5-13-14-9-12(10-16(13)19)15(14)11-24(3)23/h12,15-17H,4-11H2,1-3H3,(H,21,22)/t12-,15?,16+,17-,19-,20+,24?/m0/s1 |
| InChIKey | DHRHLHIFYKSNEC-WNUNRFJXSA-N |
| XLogP | 4.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|