C16H20N2O3 — CID 71197636
(Z)-4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]hept-2-en-3-ol (PubChem CID 71197636) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (Z)-4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]hept-2-en-3-ol.
| Compound Name | (Z)-4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]hept-2-en-3-ol |
|---|---|
| PubChem CID | 71197636 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (Z)-4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]hept-2-en-3-ol |
| SMILES | C/C=C(\O)C(CCC)Oc1cccc(-c2noc(C)n2)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-4-7-15(14(19)5-2)20-13-9-6-8-12(10-13)16-17-11(3)21-18-16/h5-6,8-10,15,19H,4,7H2,1-3H3/b14-5- |
| InChIKey | FDPUDBKOURBMIM-RZNTYIFUSA-N |
| XLogP | 4.05 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|