C17H17NO5 — CID 71200965
5-(2-acetamidophenyl)-2,4-dimethoxybenzoic acid (PubChem CID 71200965) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-(2-acetamidophenyl)-2,4-dimethoxybenzoic acid.
| Compound Name | 5-(2-acetamidophenyl)-2,4-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 71200965 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-(2-acetamidophenyl)-2,4-dimethoxybenzoic acid |
| SMILES | COc1cc(OC)c(-c2ccccc2NC(C)=O)cc1C(=O)O |
| InChI | InChI=1S/C17H17NO5/c1-10(19)18-14-7-5-4-6-11(14)12-8-13(17(20)21)16(23-3)9-15(12)22-2/h4-9H,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | WYOFGSXCRLMXDT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |