C41H39ClN6O5S2 — CID 71204806
4-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]-N-[4-[[(2R)-4-cyano-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 71204806) has the molecular formula C41H39ClN6O5S2 and a molecular weight of 795.39 g/mol. Its IUPAC name is 4-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]-N-[4-[[(2R)-4-cyano-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]-N-[4-[[(2R)-4-cyano-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 71204806 |
| Molecular Formula | C41H39ClN6O5S2 |
| Molecular Weight | 795.39 g/mol |
| Exact Mass | 794.21 |
| IUPAC Name | 4-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]-N-[4-[[(2R)-4-cyano-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | N#CCC[C@H](CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4cc(Cl)ccc4-c4ccccc4)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C41H39ClN6O5S2/c42-33-15-19-38(30-8-3-1-4-9-30)32(26-33)28-46-22-24-47(25-23-46)35-16-13-31(14-17-35)41(49)45-55(52,53)37-18-20-39(40(27-37)48(50)51)44-34(10-7-21-43)29-54-36-11-5-2-6-12-36/h1-6,8-9,11-20,26-27,34,44H,7,10,22-25,28-29H2,(H,45,49)/t34-/m1/s1 |
| InChIKey | IOASEFFDWDZVPA-UUWRZZSWSA-N |
| XLogP | 8.23 |
| TPSA | 148.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.39 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|