C29H30O14 — CID 71204877
methyl 2-[(10aR)-3-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-6a,7,10a,12-tetrahydroxy-8-methoxy-1-methyl-6,10,11-trioxo-7H-tetracen-2-yl]acetate (PubChem CID 71204877) has the molecular formula C29H30O14 and a molecular weight of 602.55 g/mol. Its IUPAC name is methyl 2-[(10aR)-3-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-6a,7,10a,12-tetrahydroxy-8-methoxy-1-methyl-6,10,11-trioxo-7H-tetracen-2-yl]acetate.
| Compound Name | methyl 2-[(10aR)-3-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-6a,7,10a,12-tetrahydroxy-8-methoxy-1-methyl-6,10,11-trioxo-7H-tetracen-2-yl]acetate |
|---|---|
| PubChem CID | 71204877 |
| Molecular Formula | C29H30O14 |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | methyl 2-[(10aR)-3-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-6a,7,10a,12-tetrahydroxy-8-methoxy-1-methyl-6,10,11-trioxo-7H-tetracen-2-yl]acetate |
| SMILES | COC(=O)Cc1c(OC2CC(O)C(O)C(C)O2)cc2cc3c(c(O)c2c1C)C(=O)[C@]1(O)C(=O)C=C(OC)C(O)C1(O)C3=O |
| InChI | InChI=1S/C29H30O14/c1-10-13(7-19(32)41-4)16(43-20-8-15(30)23(33)11(2)42-20)6-12-5-14-22(24(34)21(10)12)27(37)28(38)18(31)9-17(40-3)26(36)29(28,39)25(14)35/h5-6,9,11,15,20,23,26,30,33-34,36,38-39H,7-8H2,1-4H3/t11?,15?,20?,23?,26?,28-,29?/m1/s1 |
| InChIKey | VXTFKURJRLNZPB-ZNKJWDSFSA-N |
| XLogP | -0.88 |
| TPSA | 226.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|