C32H34O15 — CID 139589011
methyl (6aR,10aR)-6a,12-dihydroxy-8,10a-dimethoxy-1-methyl-6,7,10,11-tetraoxo-3-[(2S,3S,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxytetracene-2-carboxylate (PubChem CID 139589011) has the molecular formula C32H34O15 and a molecular weight of 658.61 g/mol. Its IUPAC name is methyl (6aR,10aR)-6a,12-dihydroxy-8,10a-dimethoxy-1-methyl-6,7,10,11-tetraoxo-3-[(2S,3S,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxytetracene-2-carboxylate.
| Compound Name | methyl (6aR,10aR)-6a,12-dihydroxy-8,10a-dimethoxy-1-methyl-6,7,10,11-tetraoxo-3-[(2S,3S,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxytetracene-2-carboxylate |
|---|---|
| PubChem CID | 139589011 |
| Molecular Formula | C32H34O15 |
| Molecular Weight | 658.61 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | methyl (6aR,10aR)-6a,12-dihydroxy-8,10a-dimethoxy-1-methyl-6,7,10,11-tetraoxo-3-[(2S,3S,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxytetracene-2-carboxylate |
| SMILES | COC(=O)c1c(O[C@@H]2O[C@@H](C)[C@H](OC)[C@@H](OC)[C@@H]2OC)cc2cc3c(c(O)c2c1C)C(=O)[C@]1(OC)C(=O)C=C(OC)C(=O)[C@]1(O)C3=O |
| InChI | InChI=1S/C32H34O15/c1-12-19-14(10-16(20(12)29(38)44-7)47-30-25(43-6)24(42-5)23(41-4)13(2)46-30)9-15-21(22(19)34)28(37)32(45-8)18(33)11-17(40-3)27(36)31(32,39)26(15)35/h9-11,13,23-25,30,34,39H,1-8H3/t13-,23-,24+,25-,30-,31+,32+/m0/s1 |
| InChIKey | MJSZOVKYEBNDOP-XOFLNJHASA-N |
| XLogP | 0.99 |
| TPSA | 199.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.61 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|