C22H18O10 — CID 15869849
methyl 3,6-diacetyloxy-9-hydroxy-7-methoxy-1-methyl-5,8-dioxoanthracene-2-carboxylate (PubChem CID 15869849) has the molecular formula C22H18O10 and a molecular weight of 442.38 g/mol. Its IUPAC name is methyl 3,6-diacetyloxy-9-hydroxy-7-methoxy-1-methyl-5,8-dioxoanthracene-2-carboxylate.
| Compound Name | methyl 3,6-diacetyloxy-9-hydroxy-7-methoxy-1-methyl-5,8-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 15869849 |
| Molecular Formula | C22H18O10 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | methyl 3,6-diacetyloxy-9-hydroxy-7-methoxy-1-methyl-5,8-dioxoanthracene-2-carboxylate |
| SMILES | COC(=O)c1c(OC(C)=O)cc2cc3c(c(O)c2c1C)C(=O)C(OC)=C(OC(C)=O)C3=O |
| InChI | InChI=1S/C22H18O10/c1-8-14-11(7-13(31-9(2)23)15(8)22(28)30-5)6-12-16(18(14)26)19(27)20(29-4)21(17(12)25)32-10(3)24/h6-7,26H,1-5H3 |
| InChIKey | BHAZYBHMKNFQAV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|