C19H14N2O4S — CID 7120970
[(1S)-1-(1,3-benzothiazol-2-yl)ethyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7120970) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is [(1S)-1-(1,3-benzothiazol-2-yl)ethyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [(1S)-1-(1,3-benzothiazol-2-yl)ethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7120970 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(1S)-1-(1,3-benzothiazol-2-yl)ethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | C[C@H](OC(=O)CN1C(=O)c2ccccc2C1=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H14N2O4S/c1-11(17-20-14-8-4-5-9-15(14)26-17)25-16(22)10-21-18(23)12-6-2-3-7-13(12)19(21)24/h2-9,11H,10H2,1H3/t11-/m0/s1 |
| InChIKey | MHKGDDZWUNBBOJ-NSHDSACASA-N |
| XLogP | 3.20 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|