C26H29NO4 — CID 71209898
14-hydroxy-9-methoxy-N-(1-phenylethyl)-11-oxatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide (PubChem CID 71209898) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 14-hydroxy-9-methoxy-N-(1-phenylethyl)-11-oxatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide.
| Compound Name | 14-hydroxy-9-methoxy-N-(1-phenylethyl)-11-oxatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 71209898 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 14-hydroxy-9-methoxy-N-(1-phenylethyl)-11-oxatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide |
| SMILES | COc1ccc2c3c1OC1CC(O)C=CC31CCC(C(=O)NC(C)c1ccccc1)C2 |
| InChI | InChI=1S/C26H29NO4/c1-16(17-6-4-3-5-7-17)27-25(29)19-10-12-26-13-11-20(28)15-22(26)31-24-21(30-2)9-8-18(14-19)23(24)26/h3-9,11,13,16,19-20,22,28H,10,12,14-15H2,1-2H3,(H,27,29) |
| InChIKey | QMPLDVQFFFBHBC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|