C28H41F2NO2 — CID 71216012
(2S,5R,8R,9R)-5-[(3,4-difluorophenyl)methylamino]-2,7,14,14-tetramethyltricyclo[8.7.0.011,15]heptadec-11(15)-ene-8,9-diol (PubChem CID 71216012) has the molecular formula C28H41F2NO2 and a molecular weight of 461.64 g/mol. Its IUPAC name is (2S,5R,8R,9R)-5-[(3,4-difluorophenyl)methylamino]-2,7,14,14-tetramethyltricyclo[8.7.0.011,15]heptadec-11(15)-ene-8,9-diol.
| Compound Name | (2S,5R,8R,9R)-5-[(3,4-difluorophenyl)methylamino]-2,7,14,14-tetramethyltricyclo[8.7.0.011,15]heptadec-11(15)-ene-8,9-diol |
|---|---|
| PubChem CID | 71216012 |
| Molecular Formula | C28H41F2NO2 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | (2S,5R,8R,9R)-5-[(3,4-difluorophenyl)methylamino]-2,7,14,14-tetramethyltricyclo[8.7.0.011,15]heptadec-11(15)-ene-8,9-diol |
| SMILES | CC1C[C@H](NCc2ccc(F)c(F)c2)CC[C@H](C)C2CCC3=C(CCC3(C)C)C2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H41F2NO2/c1-16-5-7-19(31-15-18-6-10-23(29)24(30)14-18)13-17(2)26(32)27(33)25-20(16)8-9-22-21(25)11-12-28(22,3)4/h6,10,14,16-17,19-20,25-27,31-33H,5,7-9,11-13,15H2,1-4H3/t16-,17?,19+,20?,25?,26+,27+/m0/s1 |
| InChIKey | UYTOCLQGPSWAKF-WXEHVPOOSA-N |
| XLogP | 5.74 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|