C12H10N2O3 — CID 71218770
N,2-dimethylfuro[3,2-f][1,3]benzoxazole-7-carboxamide (PubChem CID 71218770) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is N,2-dimethylfuro[3,2-f][1,3]benzoxazole-7-carboxamide.
| Compound Name | N,2-dimethylfuro[3,2-f][1,3]benzoxazole-7-carboxamide |
|---|---|
| PubChem CID | 71218770 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N,2-dimethylfuro[3,2-f][1,3]benzoxazole-7-carboxamide |
| SMILES | CNC(=O)c1coc2cc3oc(C)nc3cc12 |
| InChI | InChI=1S/C12H10N2O3/c1-6-14-9-3-7-8(12(15)13-2)5-16-10(7)4-11(9)17-6/h3-5H,1-2H3,(H,13,15) |
| InChIKey | GZTZZLTUISAYDE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |