C10H10N2OS — CID 116827719
N,2-dimethyl-1,3-benzoxazole-6-carbothioamide (PubChem CID 116827719) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is N,2-dimethyl-1,3-benzoxazole-6-carbothioamide.
| Compound Name | N,2-dimethyl-1,3-benzoxazole-6-carbothioamide |
|---|---|
| PubChem CID | 116827719 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | N,2-dimethyl-1,3-benzoxazole-6-carbothioamide |
| SMILES | CNC(=S)c1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C10H10N2OS/c1-6-12-8-4-3-7(10(14)11-2)5-9(8)13-6/h3-5H,1-2H3,(H,11,14) |
| InChIKey | HFFMDFMLDGQZQQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|