C28H33N5O3 — CID 71219876
N-cycloheptyl-7-oxo-8-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-9-carboxamide (PubChem CID 71219876) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-cycloheptyl-7-oxo-8-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-9-carboxamide.
| Compound Name | N-cycloheptyl-7-oxo-8-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-9-carboxamide |
|---|---|
| PubChem CID | 71219876 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-cycloheptyl-7-oxo-8-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-9-carboxamide |
| SMILES | O=C(NC1CCCCCC1)C1c2cccn2-c2c(cnn2-c2ccccc2)C(=O)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C28H33N5O3/c34-26(30-20-10-4-1-2-5-11-20)25-24-15-8-16-31(24)27-23(18-29-33(27)21-12-6-3-7-13-21)28(35)32(25)19-22-14-9-17-36-22/h3,6-8,12-13,15-16,18,20,22,25H,1-2,4-5,9-11,14,17,19H2,(H,30,34)/t22-,25?/m1/s1 |
| InChIKey | XLOLEIJVPMSKRF-UFUCKMQHSA-N |
| XLogP | 4.18 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |