C14H10BrNS — CID 71223808
8-bromo-2-(5-methylthiophen-3-yl)quinoline (PubChem CID 71223808) has the molecular formula C14H10BrNS and a molecular weight of 304.21 g/mol. Its IUPAC name is 8-bromo-2-(5-methylthiophen-3-yl)quinoline.
| Compound Name | 8-bromo-2-(5-methylthiophen-3-yl)quinoline |
|---|---|
| PubChem CID | 71223808 |
| Molecular Formula | C14H10BrNS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 8-bromo-2-(5-methylthiophen-3-yl)quinoline |
| SMILES | Cc1cc(-c2ccc3cccc(Br)c3n2)cs1 |
| InChI | InChI=1S/C14H10BrNS/c1-9-7-11(8-17-9)13-6-5-10-3-2-4-12(15)14(10)16-13/h2-8H,1H3 |
| InChIKey | AOJXBYVVAXXUMR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |