C19H30N2O4S — CID 71224932
2-methyl-3-[4-(1-methylpiperidin-4-yl)oxycyclohexyl]oxy-6-methylsulfonylpyridine (PubChem CID 71224932) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-methyl-3-[4-(1-methylpiperidin-4-yl)oxycyclohexyl]oxy-6-methylsulfonylpyridine.
| Compound Name | 2-methyl-3-[4-(1-methylpiperidin-4-yl)oxycyclohexyl]oxy-6-methylsulfonylpyridine |
|---|---|
| PubChem CID | 71224932 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-methyl-3-[4-(1-methylpiperidin-4-yl)oxycyclohexyl]oxy-6-methylsulfonylpyridine |
| SMILES | Cc1nc(S(C)(=O)=O)ccc1OC1CCC(OC2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C19H30N2O4S/c1-14-18(8-9-19(20-14)26(3,22)23)25-16-6-4-15(5-7-16)24-17-10-12-21(2)13-11-17/h8-9,15-17H,4-7,10-13H2,1-3H3 |
| InChIKey | RDUVSWWTGNLPDV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |