C20H28BrF3N2O2 — CID 87405208
6-bromo-2-methyl-3-[4-[1-(1,1,1-trifluoropropan-2-yl)piperidin-4-yl]oxycyclohexyl]oxypyridine (PubChem CID 87405208) has the molecular formula C20H28BrF3N2O2 and a molecular weight of 465.35 g/mol. Its IUPAC name is 6-bromo-2-methyl-3-[4-[1-(1,1,1-trifluoropropan-2-yl)piperidin-4-yl]oxycyclohexyl]oxypyridine.
| Compound Name | 6-bromo-2-methyl-3-[4-[1-(1,1,1-trifluoropropan-2-yl)piperidin-4-yl]oxycyclohexyl]oxypyridine |
|---|---|
| PubChem CID | 87405208 |
| Molecular Formula | C20H28BrF3N2O2 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 6-bromo-2-methyl-3-[4-[1-(1,1,1-trifluoropropan-2-yl)piperidin-4-yl]oxycyclohexyl]oxypyridine |
| SMILES | Cc1nc(Br)ccc1OC1CCC(OC2CCN(C(C)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C20H28BrF3N2O2/c1-13-18(7-8-19(21)25-13)28-16-5-3-15(4-6-16)27-17-9-11-26(12-10-17)14(2)20(22,23)24/h7-8,14-17H,3-6,9-12H2,1-2H3 |
| InChIKey | VLHLHWYIQWRXLJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|