C19H28N2O5S2 — CID 89388599
4-[4-[(2-methyl-6-methylsulfonyl-3-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carbothioic S-acid (PubChem CID 89388599) has the molecular formula C19H28N2O5S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-[4-[(2-methyl-6-methylsulfonyl-3-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carbothioic S-acid.
| Compound Name | 4-[4-[(2-methyl-6-methylsulfonyl-3-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 89388599 |
| Molecular Formula | C19H28N2O5S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4-[4-[(2-methyl-6-methylsulfonyl-3-pyridinyl)oxy]cyclohexyl]oxypiperidine-1-carbothioic S-acid |
| SMILES | Cc1nc(S(C)(=O)=O)ccc1OC1CCC(OC2CCN(C(=O)S)CC2)CC1 |
| InChI | InChI=1S/C19H28N2O5S2/c1-13-17(7-8-18(20-13)28(2,23)24)26-15-5-3-14(4-6-15)25-16-9-11-21(12-10-16)19(22)27/h7-8,14-16H,3-6,9-12H2,1-2H3,(H,22,27) |
| InChIKey | FLTWHMOEMBMWIJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|