C17H27N5O5S — CID 89388683
N'-hydroxy-4-[4-(5-methylsulfonylpyrazin-2-yl)oxycyclohexyl]oxypiperidine-1-carboximidamide (PubChem CID 89388683) has the molecular formula C17H27N5O5S and a molecular weight of 413.50 g/mol. Its IUPAC name is N'-hydroxy-4-[4-(5-methylsulfonylpyrazin-2-yl)oxycyclohexyl]oxypiperidine-1-carboximidamide.
| Compound Name | N'-hydroxy-4-[4-(5-methylsulfonylpyrazin-2-yl)oxycyclohexyl]oxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 89388683 |
| Molecular Formula | C17H27N5O5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N'-hydroxy-4-[4-(5-methylsulfonylpyrazin-2-yl)oxycyclohexyl]oxypiperidine-1-carboximidamide |
| SMILES | CS(=O)(=O)c1cnc(OC2CCC(OC3CCN(/C(N)=N/O)CC3)CC2)cn1 |
| InChI | InChI=1S/C17H27N5O5S/c1-28(24,25)16-11-19-15(10-20-16)27-13-4-2-12(3-5-13)26-14-6-8-22(9-7-14)17(18)21-23/h10-14,23H,2-9H2,1H3,(H2,18,21) |
| InChIKey | YPORIZLTBYDMKV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|