C18H26N8O3 — CID 123984404
N'-hydroxy-4-[4-[5-(1,2,4-triazol-1-yl)pyrazin-2-yl]oxycyclohexyl]oxypiperidine-1-carboximidamide (PubChem CID 123984404) has the molecular formula C18H26N8O3 and a molecular weight of 402.46 g/mol. Its IUPAC name is N'-hydroxy-4-[4-[5-(1,2,4-triazol-1-yl)pyrazin-2-yl]oxycyclohexyl]oxypiperidine-1-carboximidamide.
| Compound Name | N'-hydroxy-4-[4-[5-(1,2,4-triazol-1-yl)pyrazin-2-yl]oxycyclohexyl]oxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 123984404 |
| Molecular Formula | C18H26N8O3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N'-hydroxy-4-[4-[5-(1,2,4-triazol-1-yl)pyrazin-2-yl]oxycyclohexyl]oxypiperidine-1-carboximidamide |
| SMILES | NC(=NO)N1CCC(OC2CCC(Oc3cnc(-n4cncn4)cn3)CC2)CC1 |
| InChI | InChI=1S/C18H26N8O3/c19-18(24-27)25-7-5-15(6-8-25)28-13-1-3-14(4-2-13)29-17-10-21-16(9-22-17)26-12-20-11-23-26/h9-15,27H,1-8H2,(H2,19,24) |
| InChIKey | RVEJBCGUBLYPPT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|